C31H41N3O5S — CID 68889250
N-[1-[4-(2-methoxy-4,4-dimethylpentanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-thiophen-2-ylbenzamide (PubChem CID 68889250) has the molecular formula C31H41N3O5S and a molecular weight of 567.75 g/mol. Its IUPAC name is N-[1-[4-(2-methoxy-4,4-dimethylpentanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-thiophen-2-ylbenzamide.
| Compound Name | N-[1-[4-(2-methoxy-4,4-dimethylpentanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-thiophen-2-ylbenzamide |
|---|---|
| PubChem CID | 68889250 |
| Molecular Formula | C31H41N3O5S |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | N-[1-[4-(2-methoxy-4,4-dimethylpentanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-thiophen-2-ylbenzamide |
| SMILES | COC(CC(C)(C)C)C(=O)N1CC(=O)C2C1CCN2C(=O)C(CC(C)C)NC(=O)c1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C31H41N3O5S/c1-19(2)16-22(32-28(36)21-11-9-20(10-12-21)26-8-7-15-40-26)29(37)33-14-13-23-27(33)24(35)18-34(23)30(38)25(39-6)17-31(3,4)5/h7-12,15,19,22-23,25,27H,13-14,16-18H2,1-6H3,(H,32,36) |
| InChIKey | AILIYMFLZUCRRB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |