C23H42N2O4 — CID 143075053
acetylene;tert-butyl N-[(2S)-1-[(2S)-2,6-dimethyl-1,5-oxazocan-5-yl]-4-methyl-1-oxopentan-2-yl]carbamate;ethene (PubChem CID 143075053) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is acetylene;tert-butyl N-[(2S)-1-[(2S)-2,6-dimethyl-1,5-oxazocan-5-yl]-4-methyl-1-oxopentan-2-yl]carbamate;ethene.
| Compound Name | acetylene;tert-butyl N-[(2S)-1-[(2S)-2,6-dimethyl-1,5-oxazocan-5-yl]-4-methyl-1-oxopentan-2-yl]carbamate;ethene |
|---|---|
| PubChem CID | 143075053 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | acetylene;tert-butyl N-[(2S)-1-[(2S)-2,6-dimethyl-1,5-oxazocan-5-yl]-4-methyl-1-oxopentan-2-yl]carbamate;ethene |
| SMILES | C#C.C=C.CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@H](C)OCCC1C |
| InChI | InChI=1S/C19H36N2O4.C2H4.C2H2/c1-13(2)12-16(20-18(23)25-19(5,6)7)17(22)21-10-8-15(4)24-11-9-14(21)3;2*1-2/h13-16H,8-12H2,1-7H3,(H,20,23);1-2H2;1-2H/t14?,15-,16-;;/m0../s1 |
| InChIKey | BEBWBVGOWVFAMU-XBIHZYTKSA-N |
| XLogP | 4.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|