C24H38Cl2N2O9 — CID 158975266
tert-butyl (3aS,6R,6aS)-6-chloro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate;tert-butyl (3aS,6R,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 158975266) has the molecular formula C24H38Cl2N2O9 and a molecular weight of 569.48 g/mol. Its IUPAC name is tert-butyl (3aS,6R,6aS)-6-chloro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate;tert-butyl (3aS,6R,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3aS,6R,6aS)-6-chloro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate;tert-butyl (3aS,6R,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 158975266 |
| Molecular Formula | C24H38Cl2N2O9 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | tert-butyl (3aS,6R,6aS)-6-chloro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate;tert-butyl (3aS,6R,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](Cl)[C@H]2OCC(=O)[C@H]21.COC1(OC)CO[C@@H]2[C@H](Cl)CN(C(=O)OC(C)(C)C)[C@@H]21 |
| InChI | InChI=1S/C13H22ClNO5.C11H16ClNO4/c1-12(2,3)20-11(16)15-6-8(14)9-10(15)13(17-4,18-5)7-19-9;1-11(2,3)17-10(15)13-4-6(12)9-8(13)7(14)5-16-9/h8-10H,6-7H2,1-5H3;6,8-9H,4-5H2,1-3H3/t8-,9-,10+;6-,8-,9-/m11/s1 |
| InChIKey | JOHUBHZFWXTTJB-TZWIHEHGSA-N |
| XLogP | 2.78 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|