C16H28N2O5 — CID 10664049
ditert-butyl 3-hydroxy-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole-1,5-dicarboxylate (PubChem CID 10664049) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is ditert-butyl 3-hydroxy-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole-1,5-dicarboxylate.
| Compound Name | ditert-butyl 3-hydroxy-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole-1,5-dicarboxylate |
|---|---|
| PubChem CID | 10664049 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | ditert-butyl 3-hydroxy-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole-1,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2C(O)CN(C(=O)OC(C)(C)C)C2C1 |
| InChI | InChI=1S/C16H28N2O5/c1-15(2,3)22-13(20)17-7-10-11(8-17)18(9-12(10)19)14(21)23-16(4,5)6/h10-12,19H,7-9H2,1-6H3 |
| InChIKey | VGXFZDRBMNAGKP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |