C24H25ClN6O3 — CID 129229565
1-[2-[(2R,3aR,6aR)-2-[2-[(6-chloro-2-pyridinyl)amino]-2-oxoethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-2-oxoethyl]indazole-3-carboxamide (PubChem CID 129229565) has the molecular formula C24H25ClN6O3 and a molecular weight of 480.96 g/mol. Its IUPAC name is 1-[2-[(2R,3aR,6aR)-2-[2-[(6-chloro-2-pyridinyl)amino]-2-oxoethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-2-oxoethyl]indazole-3-carboxamide.
| Compound Name | 1-[2-[(2R,3aR,6aR)-2-[2-[(6-chloro-2-pyridinyl)amino]-2-oxoethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-2-oxoethyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 129229565 |
| Molecular Formula | C24H25ClN6O3 |
| Molecular Weight | 480.96 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 1-[2-[(2R,3aR,6aR)-2-[2-[(6-chloro-2-pyridinyl)amino]-2-oxoethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-2-oxoethyl]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(CC(=O)N2[C@@H](CC(=O)Nc3cccc(Cl)n3)C[C@H]3CCC[C@H]32)c2ccccc12 |
| InChI | InChI=1S/C24H25ClN6O3/c25-19-9-4-10-20(27-19)28-21(32)12-15-11-14-5-3-8-17(14)31(15)22(33)13-30-18-7-2-1-6-16(18)23(29-30)24(26)34/h1-2,4,6-7,9-10,14-15,17H,3,5,8,11-13H2,(H2,26,34)(H,27,28,32)/t14-,15-,17-/m1/s1 |
| InChIKey | OKCYBYUBWLCRBE-BFYDXBDKSA-N |
| XLogP | 2.98 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.96 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|