About (1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane
(1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane (PubChem CID 129230068) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is (1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane.
Analyze (1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane?
The IUPAC name of (1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane (CID 129230068) is (1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane.
What is the SMILES notation for (1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane?
The canonical SMILES for (1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane is CN1C[C@H]2CC3C[C@@H]1[C@H]32.
What is the InChIKey of (1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane?
The InChIKey is HNKNGGAEQKWMAG-UIYHXYAWSA-N. The full InChI is InChI=1S/C8H13N/c1-9-4-6-2-5-3-7(9)8(5)6/h5-8H,2-4H2,1H3/t5?,6-,7-,8-/m1/s1.
What are the key properties of (1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane?
(1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane has a molecular weight of 123.20 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R,8R)-6-methyl-6-azatricyclo[3.2.1.03,8]octane is sourced from PubChem (CID 129230068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).