C17H13F3N4O3S — CID 129233340
ethyl 2-[[1-[(3,4,5-trifluorophenyl)methyl]imidazole-4-carbonyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 129233340) has the molecular formula C17H13F3N4O3S and a molecular weight of 410.38 g/mol. Its IUPAC name is ethyl 2-[[1-[(3,4,5-trifluorophenyl)methyl]imidazole-4-carbonyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[1-[(3,4,5-trifluorophenyl)methyl]imidazole-4-carbonyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 129233340 |
| Molecular Formula | C17H13F3N4O3S |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | ethyl 2-[[1-[(3,4,5-trifluorophenyl)methyl]imidazole-4-carbonyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC(=O)c2cn(Cc3cc(F)c(F)c(F)c3)cn2)n1 |
| InChI | InChI=1S/C17H13F3N4O3S/c1-2-27-16(26)13-7-28-17(22-13)23-15(25)12-6-24(8-21-12)5-9-3-10(18)14(20)11(19)4-9/h3-4,6-8H,2,5H2,1H3,(H,22,23,25) |
| InChIKey | NWLMPRGALZQALJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|