C9H12Cl2N2O2 — CID 12923517
1-(2,2-dichloroacetyl)-7a-methyl-2,3,6,7-tetrahydropyrrolo[1,2-a]imidazol-5-one (PubChem CID 12923517) has the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. Its IUPAC name is 1-(2,2-dichloroacetyl)-7a-methyl-2,3,6,7-tetrahydropyrrolo[1,2-a]imidazol-5-one.
| Compound Name | 1-(2,2-dichloroacetyl)-7a-methyl-2,3,6,7-tetrahydropyrrolo[1,2-a]imidazol-5-one |
|---|---|
| PubChem CID | 12923517 |
| Molecular Formula | C9H12Cl2N2O2 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 1-(2,2-dichloroacetyl)-7a-methyl-2,3,6,7-tetrahydropyrrolo[1,2-a]imidazol-5-one |
| SMILES | CC12CCC(=O)N1CCN2C(=O)C(Cl)Cl |
| InChI | InChI=1S/C9H12Cl2N2O2/c1-9-3-2-6(14)12(9)4-5-13(9)8(15)7(10)11/h7H,2-5H2,1H3 |
| InChIKey | WUFNUZBFFMUNSN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|