C24H23N5O4S3 — CID 129235751
2-[N-(1,3-benzothiazol-6-ylmethyl)-4-cyanoanilino]-N-(3-methoxypropylsulfonyl)-5-methyl-1,3-thiazole-4-carboxamide (PubChem CID 129235751) has the molecular formula C24H23N5O4S3 and a molecular weight of 541.68 g/mol. Its IUPAC name is 2-[N-(1,3-benzothiazol-6-ylmethyl)-4-cyanoanilino]-N-(3-methoxypropylsulfonyl)-5-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[N-(1,3-benzothiazol-6-ylmethyl)-4-cyanoanilino]-N-(3-methoxypropylsulfonyl)-5-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129235751 |
| Molecular Formula | C24H23N5O4S3 |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 2-[N-(1,3-benzothiazol-6-ylmethyl)-4-cyanoanilino]-N-(3-methoxypropylsulfonyl)-5-methyl-1,3-thiazole-4-carboxamide |
| SMILES | COCCCS(=O)(=O)NC(=O)c1nc(N(Cc2ccc3ncsc3c2)c2ccc(C#N)cc2)sc1C |
| InChI | InChI=1S/C24H23N5O4S3/c1-16-22(23(30)28-36(31,32)11-3-10-33-2)27-24(35-16)29(19-7-4-17(13-25)5-8-19)14-18-6-9-20-21(12-18)34-15-26-20/h4-9,12,15H,3,10-11,14H2,1-2H3,(H,28,30) |
| InChIKey | RGLIBCBIAZXXQN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|