C25H26N4O4S2 — CID 129236177
2-(N-benzyl-4-cyanoanilino)-5-cyclopropyl-N-(3-methoxypropylsulfonyl)-1,3-thiazole-4-carboxamide (PubChem CID 129236177) has the molecular formula C25H26N4O4S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 2-(N-benzyl-4-cyanoanilino)-5-cyclopropyl-N-(3-methoxypropylsulfonyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(N-benzyl-4-cyanoanilino)-5-cyclopropyl-N-(3-methoxypropylsulfonyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129236177 |
| Molecular Formula | C25H26N4O4S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 2-(N-benzyl-4-cyanoanilino)-5-cyclopropyl-N-(3-methoxypropylsulfonyl)-1,3-thiazole-4-carboxamide |
| SMILES | COCCCS(=O)(=O)NC(=O)c1nc(N(Cc2ccccc2)c2ccc(C#N)cc2)sc1C1CC1 |
| InChI | InChI=1S/C25H26N4O4S2/c1-33-14-5-15-35(31,32)28-24(30)22-23(20-10-11-20)34-25(27-22)29(17-19-6-3-2-4-7-19)21-12-8-18(16-26)9-13-21/h2-4,6-9,12-13,20H,5,10-11,14-15,17H2,1H3,(H,28,30) |
| InChIKey | XELKKJYEIAMVRL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|