C22H22N4OS2 — CID 145326600
N-[2-(N-benzyl-4-cyanoanilino)-5-methyl-1,3-thiazol-4-yl]formamide;cyclopropanethiol (PubChem CID 145326600) has the molecular formula C22H22N4OS2 and a molecular weight of 422.58 g/mol. Its IUPAC name is N-[2-(N-benzyl-4-cyanoanilino)-5-methyl-1,3-thiazol-4-yl]formamide;cyclopropanethiol.
| Compound Name | N-[2-(N-benzyl-4-cyanoanilino)-5-methyl-1,3-thiazol-4-yl]formamide;cyclopropanethiol |
|---|---|
| PubChem CID | 145326600 |
| Molecular Formula | C22H22N4OS2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[2-(N-benzyl-4-cyanoanilino)-5-methyl-1,3-thiazol-4-yl]formamide;cyclopropanethiol |
| SMILES | Cc1sc(N(Cc2ccccc2)c2ccc(C#N)cc2)nc1NC=O.SC1CC1 |
| InChI | InChI=1S/C19H16N4OS.C3H6S/c1-14-18(21-13-24)22-19(25-14)23(12-16-5-3-2-4-6-16)17-9-7-15(11-20)8-10-17;4-3-1-2-3/h2-10,13H,12H2,1H3,(H,21,24);3-4H,1-2H2 |
| InChIKey | GFAJFGLDEHXZTD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|