C22H31N5OS2 — CID 145326577
N-[2-[4-cyano-N-[[4-(dimethylamino)cyclohexyl]methyl]anilino]-5-methyl-1,3-thiazol-4-yl]formamide;methanethiol (PubChem CID 145326577) has the molecular formula C22H31N5OS2 and a molecular weight of 445.66 g/mol. Its IUPAC name is N-[2-[4-cyano-N-[[4-(dimethylamino)cyclohexyl]methyl]anilino]-5-methyl-1,3-thiazol-4-yl]formamide;methanethiol.
| Compound Name | N-[2-[4-cyano-N-[[4-(dimethylamino)cyclohexyl]methyl]anilino]-5-methyl-1,3-thiazol-4-yl]formamide;methanethiol |
|---|---|
| PubChem CID | 145326577 |
| Molecular Formula | C22H31N5OS2 |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[2-[4-cyano-N-[[4-(dimethylamino)cyclohexyl]methyl]anilino]-5-methyl-1,3-thiazol-4-yl]formamide;methanethiol |
| SMILES | CS.Cc1sc(N(CC2CCC(N(C)C)CC2)c2ccc(C#N)cc2)nc1NC=O |
| InChI | InChI=1S/C21H27N5OS.CH4S/c1-15-20(23-14-27)24-21(28-15)26(19-10-4-16(12-22)5-11-19)13-17-6-8-18(9-7-17)25(2)3;1-2/h4-5,10-11,14,17-18H,6-9,13H2,1-3H3,(H,23,27);2H,1H3 |
| InChIKey | HMCBJMRGTGQBEP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|