C18H15N5OS — CID 145326607
N-[2-[4-cyano-N-(pyridin-2-ylmethyl)anilino]-5-methyl-1,3-thiazol-4-yl]formamide (PubChem CID 145326607) has the molecular formula C18H15N5OS and a molecular weight of 349.42 g/mol. Its IUPAC name is N-[2-[4-cyano-N-(pyridin-2-ylmethyl)anilino]-5-methyl-1,3-thiazol-4-yl]formamide.
| Compound Name | N-[2-[4-cyano-N-(pyridin-2-ylmethyl)anilino]-5-methyl-1,3-thiazol-4-yl]formamide |
|---|---|
| PubChem CID | 145326607 |
| Molecular Formula | C18H15N5OS |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[2-[4-cyano-N-(pyridin-2-ylmethyl)anilino]-5-methyl-1,3-thiazol-4-yl]formamide |
| SMILES | Cc1sc(N(Cc2ccccn2)c2ccc(C#N)cc2)nc1NC=O |
| InChI | InChI=1S/C18H15N5OS/c1-13-17(21-12-24)22-18(25-13)23(11-15-4-2-3-9-20-15)16-7-5-14(10-19)6-8-16/h2-9,12H,11H2,1H3,(H,21,24) |
| InChIKey | CAETVGADBHECQR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|