C20H14N4OS2 — CID 155028039
4-[1,3-benzothiazol-2-ylmethyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile (PubChem CID 155028039) has the molecular formula C20H14N4OS2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 4-[1,3-benzothiazol-2-ylmethyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile.
| Compound Name | 4-[1,3-benzothiazol-2-ylmethyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 155028039 |
| Molecular Formula | C20H14N4OS2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 4-[1,3-benzothiazol-2-ylmethyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile |
| SMILES | Cc1sc(N(Cc2nc3ccccc3s2)c2ccc(C#N)cc2)nc1C=O |
| InChI | InChI=1S/C20H14N4OS2/c1-13-17(12-25)23-20(26-13)24(15-8-6-14(10-21)7-9-15)11-19-22-16-4-2-3-5-18(16)27-19/h2-9,12H,11H2,1H3 |
| InChIKey | HUYAFFTZXPEZSW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|