C20H16ClN3OS — CID 145326787
4-[2-(3-chlorophenyl)ethyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile (PubChem CID 145326787) has the molecular formula C20H16ClN3OS and a molecular weight of 381.89 g/mol. Its IUPAC name is 4-[2-(3-chlorophenyl)ethyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile.
| Compound Name | 4-[2-(3-chlorophenyl)ethyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 145326787 |
| Molecular Formula | C20H16ClN3OS |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-[2-(3-chlorophenyl)ethyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile |
| SMILES | Cc1sc(N(CCc2cccc(Cl)c2)c2ccc(C#N)cc2)nc1C=O |
| InChI | InChI=1S/C20H16ClN3OS/c1-14-19(13-25)23-20(26-14)24(18-7-5-16(12-22)6-8-18)10-9-15-3-2-4-17(21)11-15/h2-8,11,13H,9-10H2,1H3 |
| InChIKey | YJLJOZWRFQHPPX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|