C20H17N3O2S — CID 155028017
4-[(4-formyl-5-methyl-1,3-thiazol-2-yl)-(2-hydroxy-2-phenylethyl)amino]benzonitrile (PubChem CID 155028017) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-[(4-formyl-5-methyl-1,3-thiazol-2-yl)-(2-hydroxy-2-phenylethyl)amino]benzonitrile.
| Compound Name | 4-[(4-formyl-5-methyl-1,3-thiazol-2-yl)-(2-hydroxy-2-phenylethyl)amino]benzonitrile |
|---|---|
| PubChem CID | 155028017 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 4-[(4-formyl-5-methyl-1,3-thiazol-2-yl)-(2-hydroxy-2-phenylethyl)amino]benzonitrile |
| SMILES | Cc1sc(N(CC(O)c2ccccc2)c2ccc(C#N)cc2)nc1C=O |
| InChI | InChI=1S/C20H17N3O2S/c1-14-18(13-24)22-20(26-14)23(17-9-7-15(11-21)8-10-17)12-19(25)16-5-3-2-4-6-16/h2-10,13,19,25H,12H2,1H3 |
| InChIKey | YJRSQRBMUIYXPY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|