C25H23N5OS2 — CID 145326731
4-[benzyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile;N-pyridin-3-ylsulfanylmethanamine (PubChem CID 145326731) has the molecular formula C25H23N5OS2 and a molecular weight of 473.63 g/mol. Its IUPAC name is 4-[benzyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile;N-pyridin-3-ylsulfanylmethanamine.
| Compound Name | 4-[benzyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile;N-pyridin-3-ylsulfanylmethanamine |
|---|---|
| PubChem CID | 145326731 |
| Molecular Formula | C25H23N5OS2 |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 4-[benzyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile;N-pyridin-3-ylsulfanylmethanamine |
| SMILES | CNSc1cccnc1.Cc1sc(N(Cc2ccccc2)c2ccc(C#N)cc2)nc1C=O |
| InChI | InChI=1S/C19H15N3OS.C6H8N2S/c1-14-18(13-23)21-19(24-14)22(12-16-5-3-2-4-6-16)17-9-7-15(11-20)8-10-17;1-7-9-6-3-2-4-8-5-6/h2-10,13H,12H2,1H3;2-5,7H,1H3 |
| InChIKey | XQSLEAQUDUOPJQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|