C20H15F2N3OS — CID 155027715
4-[[2-(difluoromethyl)phenyl]methyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile (PubChem CID 155027715) has the molecular formula C20H15F2N3OS and a molecular weight of 383.42 g/mol. Its IUPAC name is 4-[[2-(difluoromethyl)phenyl]methyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile.
| Compound Name | 4-[[2-(difluoromethyl)phenyl]methyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 155027715 |
| Molecular Formula | C20H15F2N3OS |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 4-[[2-(difluoromethyl)phenyl]methyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]benzonitrile |
| SMILES | Cc1sc(N(Cc2ccccc2C(F)F)c2ccc(C#N)cc2)nc1C=O |
| InChI | InChI=1S/C20H15F2N3OS/c1-13-18(12-26)24-20(27-13)25(16-8-6-14(10-23)7-9-16)11-15-4-2-3-5-17(15)19(21)22/h2-9,12,19H,11H2,1H3 |
| InChIKey | BWIMJKMXZDEPOM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|