C21H18F3N3O2S — CID 155028050
4-[(4-formyl-5-methyl-1,3-thiazol-2-yl)-[(2E,4E)-2-methyl-5-(trifluoromethoxy)hepta-2,4,6-trienyl]amino]benzonitrile (PubChem CID 155028050) has the molecular formula C21H18F3N3O2S and a molecular weight of 433.46 g/mol. Its IUPAC name is 4-[(4-formyl-5-methyl-1,3-thiazol-2-yl)-[(2E,4E)-2-methyl-5-(trifluoromethoxy)hepta-2,4,6-trienyl]amino]benzonitrile.
| Compound Name | 4-[(4-formyl-5-methyl-1,3-thiazol-2-yl)-[(2E,4E)-2-methyl-5-(trifluoromethoxy)hepta-2,4,6-trienyl]amino]benzonitrile |
|---|---|
| PubChem CID | 155028050 |
| Molecular Formula | C21H18F3N3O2S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 4-[(4-formyl-5-methyl-1,3-thiazol-2-yl)-[(2E,4E)-2-methyl-5-(trifluoromethoxy)hepta-2,4,6-trienyl]amino]benzonitrile |
| SMILES | C=C/C(=C\C=C(/C)CN(c1ccc(C#N)cc1)c1nc(C=O)c(C)s1)OC(F)(F)F |
| InChI | InChI=1S/C21H18F3N3O2S/c1-4-18(29-21(22,23)24)10-5-14(2)12-27(17-8-6-16(11-25)7-9-17)20-26-19(13-28)15(3)30-20/h4-10,13H,1,12H2,2-3H3/b14-5+,18-10+ |
| InChIKey | SNNRHAKBHOWDED-NCWXLEBASA-N |
| XLogP | 5.83 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|