About 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile
4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile (PubChem CID 155027703) has the molecular formula C20H16F3N3S
and a molecular weight of 387.43 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile |
| PubChem CID | 155027703 |
| Molecular Formula | C20H16F3N3S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile |
| SMILES | Cc1nc(N(Cc2ccc(C(F)(F)F)cc2)c2ccc(C#N)cc2)sc1C |
| InChI | InChI=1S/C20H16F3N3S/c1-13-14(2)27-19(25-13)26(18-9-5-15(11-24)6-10-18)12-16-3-7-17(8-4-16)20(21,22)23/h3-10H,12H2,1-2H3 |
| InChIKey | PCUYQMIPYHDKJN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile?
The IUPAC name of 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile (CID 155027703) is 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile.
What is the SMILES notation for 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile?
The canonical SMILES for 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile is Cc1nc(N(Cc2ccc(C(F)(F)F)cc2)c2ccc(C#N)cc2)sc1C.
What is the InChIKey of 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile?
The InChIKey is PCUYQMIPYHDKJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F3N3S/c1-13-14(2)27-19(25-13)26(18-9-5-15(11-24)6-10-18)12-16-3-7-17(8-4-16)20(21,22)23/h3-10H,12H2,1-2H3.
What are the key properties of 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile?
4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile has a molecular weight of 387.43 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile is sourced from PubChem (CID 155027703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).