C21H18ClN3OS — CID 155028175
4-[2-[(4-chlorophenyl)methyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]ethyl]benzonitrile (PubChem CID 155028175) has the molecular formula C21H18ClN3OS and a molecular weight of 395.92 g/mol. Its IUPAC name is 4-[2-[(4-chlorophenyl)methyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]ethyl]benzonitrile.
| Compound Name | 4-[2-[(4-chlorophenyl)methyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 155028175 |
| Molecular Formula | C21H18ClN3OS |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-[2-[(4-chlorophenyl)methyl-(4-formyl-5-methyl-1,3-thiazol-2-yl)amino]ethyl]benzonitrile |
| SMILES | Cc1sc(N(CCc2ccc(C#N)cc2)Cc2ccc(Cl)cc2)nc1C=O |
| InChI | InChI=1S/C21H18ClN3OS/c1-15-20(14-26)24-21(27-15)25(13-18-6-8-19(22)9-7-18)11-10-16-2-4-17(12-23)5-3-16/h2-9,14H,10-11,13H2,1H3 |
| InChIKey | IMVMDOWRQVTJSV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|