C53H41NS — CID 129236064
N-[4-[6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-14,14-dimethyl-6-tetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7,9,11-hexaenyl]phenyl]-N-(4-phenylphenyl)dibenzothiophen-3-amine (PubChem CID 129236064) has the molecular formula C53H41NS and a molecular weight of 723.99 g/mol. Its IUPAC name is N-[4-[6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-14,14-dimethyl-6-tetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7,9,11-hexaenyl]phenyl]-N-(4-phenylphenyl)dibenzothiophen-3-amine.
| Compound Name | N-[4-[6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-14,14-dimethyl-6-tetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7,9,11-hexaenyl]phenyl]-N-(4-phenylphenyl)dibenzothiophen-3-amine |
|---|---|
| PubChem CID | 129236064 |
| Molecular Formula | C53H41NS |
| Molecular Weight | 723.99 g/mol |
| Exact Mass | 723.30 |
| IUPAC Name | N-[4-[6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-14,14-dimethyl-6-tetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7,9,11-hexaenyl]phenyl]-N-(4-phenylphenyl)dibenzothiophen-3-amine |
| SMILES | C=C(/C=C\C=C/C)C1(c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)sc3ccccc34)cc2)c2cccc3c2-c2c(cccc21)C3(C)C |
| InChI | InChI=1S/C53H41NS/c1-5-6-8-15-35(2)53(46-21-13-19-44-50(46)51-45(52(44,3)4)20-14-22-47(51)53)38-26-30-40(31-27-38)54(39-28-24-37(25-29-39)36-16-9-7-10-17-36)41-32-33-43-42-18-11-12-23-48(42)55-49(43)34-41/h5-34H,2H2,1,3-4H3/b6-5-,15-8- |
| InChIKey | NTOWUFNAFROZIW-KZZFBBJTSA-N |
| XLogP | 14.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.99 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|