C13H16O7S — CID 129239231
2-(3-methoxyphenyl)-3-(2-methylsulfonylethoxy)-3-oxopropanoic acid (PubChem CID 129239231) has the molecular formula C13H16O7S and a molecular weight of 316.33 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-3-(2-methylsulfonylethoxy)-3-oxopropanoic acid.
| Compound Name | 2-(3-methoxyphenyl)-3-(2-methylsulfonylethoxy)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 129239231 |
| Molecular Formula | C13H16O7S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-(3-methoxyphenyl)-3-(2-methylsulfonylethoxy)-3-oxopropanoic acid |
| SMILES | COc1cccc(C(C(=O)O)C(=O)OCCS(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H16O7S/c1-19-10-5-3-4-9(8-10)11(12(14)15)13(16)20-6-7-21(2,17)18/h3-5,8,11H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | BDBJVCOCGBWTBZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|