About 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile
5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile (PubChem CID 129240771) has the molecular formula C15H16N4O
and a molecular weight of 268.32 g/mol. Its IUPAC name is 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile.
Molecular Properties
| Compound Name | 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile |
| PubChem CID | 129240771 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncncc23)C[C@H](C)O1 |
| InChI | InChI=1S/C15H16N4O/c1-10-7-19(8-11(2)20-10)14-4-3-12(5-16)15-13(14)6-17-9-18-15/h3-4,6,9-11H,7-8H2,1-2H3/t10-,11+ |
| InChIKey | RKERLAZKCFZYLE-PHIMTYICSA-N |
| XLogP | 2.12 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile?
The IUPAC name of 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile (CID 129240771) is 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile.
What is the SMILES notation for 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile?
The canonical SMILES for 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile is C[C@@H]1CN(c2ccc(C#N)c3ncncc23)C[C@H](C)O1.
What is the InChIKey of 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile?
The InChIKey is RKERLAZKCFZYLE-PHIMTYICSA-N. The full InChI is InChI=1S/C15H16N4O/c1-10-7-19(8-11(2)20-10)14-4-3-12(5-16)15-13(14)6-17-9-18-15/h3-4,6,9-11H,7-8H2,1-2H3/t10-,11+.
What are the key properties of 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile?
5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile has a molecular weight of 268.32 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinazoline-8-carbonitrile is sourced from PubChem (CID 129240771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).