C16H20FN3 — CID 129241091
(3R,5S)-1-(7-fluoro-8-methylquinolin-5-yl)-5-methylpiperidin-3-amine (PubChem CID 129241091) has the molecular formula C16H20FN3 and a molecular weight of 273.35 g/mol. Its IUPAC name is (3R,5S)-1-(7-fluoro-8-methylquinolin-5-yl)-5-methylpiperidin-3-amine.
| Compound Name | (3R,5S)-1-(7-fluoro-8-methylquinolin-5-yl)-5-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 129241091 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (3R,5S)-1-(7-fluoro-8-methylquinolin-5-yl)-5-methylpiperidin-3-amine |
| SMILES | Cc1c(F)cc(N2C[C@@H](C)C[C@@H](N)C2)c2cccnc12 |
| InChI | InChI=1S/C16H20FN3/c1-10-6-12(18)9-20(8-10)15-7-14(17)11(2)16-13(15)4-3-5-19-16/h3-5,7,10,12H,6,8-9,18H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | PUYYSTDMIASSPA-CMPLNLGQSA-N |
| XLogP | 2.86 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |