C14H18N4 — CID 129240529
(3R,5S)-5-methyl-1-quinoxalin-5-ylpiperidin-3-amine (PubChem CID 129240529) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is (3R,5S)-5-methyl-1-quinoxalin-5-ylpiperidin-3-amine.
| Compound Name | (3R,5S)-5-methyl-1-quinoxalin-5-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 129240529 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (3R,5S)-5-methyl-1-quinoxalin-5-ylpiperidin-3-amine |
| SMILES | C[C@H]1C[C@@H](N)CN(c2cccc3nccnc23)C1 |
| InChI | InChI=1S/C14H18N4/c1-10-7-11(15)9-18(8-10)13-4-2-3-12-14(13)17-6-5-16-12/h2-6,10-11H,7-9,15H2,1H3/t10-,11+/m0/s1 |
| InChIKey | MKOARONGGCZDLR-WDEREUQCSA-N |
| XLogP | 1.80 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |