C21H30N2O4S — CID 129241227
4-(4-methoxyphenyl)-1,1-dimethyl-1,4-diazepan-1-ium;4-methylbenzenesulfonate (PubChem CID 129241227) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1,1-dimethyl-1,4-diazepan-1-ium;4-methylbenzenesulfonate.
| Compound Name | 4-(4-methoxyphenyl)-1,1-dimethyl-1,4-diazepan-1-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 129241227 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 4-(4-methoxyphenyl)-1,1-dimethyl-1,4-diazepan-1-ium;4-methylbenzenesulfonate |
| SMILES | COc1ccc(N2CCC[N+](C)(C)CC2)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C14H23N2O.C7H8O3S/c1-16(2)11-4-9-15(10-12-16)13-5-7-14(17-3)8-6-13;1-6-2-4-7(5-3-6)11(8,9)10/h5-8H,4,9-12H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | JQUMLDMUISJHEF-UHFFFAOYSA-M |
| XLogP | 2.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|