C19H10F4N2O4 — CID 129244085
5,6-bis(2,2-difluoro-1,3-benzodioxol-4-yl)pyridin-3-amine (PubChem CID 129244085) has the molecular formula C19H10F4N2O4 and a molecular weight of 406.29 g/mol. Its IUPAC name is 5,6-bis(2,2-difluoro-1,3-benzodioxol-4-yl)pyridin-3-amine.
| Compound Name | 5,6-bis(2,2-difluoro-1,3-benzodioxol-4-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 129244085 |
| Molecular Formula | C19H10F4N2O4 |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 5,6-bis(2,2-difluoro-1,3-benzodioxol-4-yl)pyridin-3-amine |
| SMILES | Nc1cnc(-c2cccc3c2OC(F)(F)O3)c(-c2cccc3c2OC(F)(F)O3)c1 |
| InChI | InChI=1S/C19H10F4N2O4/c20-18(21)26-13-5-1-3-10(16(13)28-18)12-7-9(24)8-25-15(12)11-4-2-6-14-17(11)29-19(22,23)27-14/h1-8H,24H2 |
| InChIKey | UQCNZIAIOWZXMN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |