C16H21N3O2 — CID 129245711
4-(3-methoxy-4-pyridinyl)-3-(2-methylpropoxy)benzene-1,2-diamine (PubChem CID 129245711) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-(3-methoxy-4-pyridinyl)-3-(2-methylpropoxy)benzene-1,2-diamine.
| Compound Name | 4-(3-methoxy-4-pyridinyl)-3-(2-methylpropoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 129245711 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-(3-methoxy-4-pyridinyl)-3-(2-methylpropoxy)benzene-1,2-diamine |
| SMILES | COc1cnccc1-c1ccc(N)c(N)c1OCC(C)C |
| InChI | InChI=1S/C16H21N3O2/c1-10(2)9-21-16-12(4-5-13(17)15(16)18)11-6-7-19-8-14(11)20-3/h4-8,10H,9,17-18H2,1-3H3 |
| InChIKey | SBIZYNHAEQOQPH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|