C15H18N2O4 — CID 15366420
4-[3,4-dimethoxy-2-(methoxymethoxy)phenyl]pyridin-3-amine (PubChem CID 15366420) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-[3,4-dimethoxy-2-(methoxymethoxy)phenyl]pyridin-3-amine.
| Compound Name | 4-[3,4-dimethoxy-2-(methoxymethoxy)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 15366420 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-[3,4-dimethoxy-2-(methoxymethoxy)phenyl]pyridin-3-amine |
| SMILES | COCOc1c(-c2ccncc2N)ccc(OC)c1OC |
| InChI | InChI=1S/C15H18N2O4/c1-18-9-21-14-11(10-6-7-17-8-12(10)16)4-5-13(19-2)15(14)20-3/h4-8H,9,16H2,1-3H3 |
| InChIKey | KOBQOGRIEIBONB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|