C16H21N5O — CID 129246902
N-[(1-cyanopyrrolidin-3-yl)methyl]-4-pyrrolidin-1-ylpyridine-2-carboxamide (PubChem CID 129246902) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is N-[(1-cyanopyrrolidin-3-yl)methyl]-4-pyrrolidin-1-ylpyridine-2-carboxamide.
| Compound Name | N-[(1-cyanopyrrolidin-3-yl)methyl]-4-pyrrolidin-1-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 129246902 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N-[(1-cyanopyrrolidin-3-yl)methyl]-4-pyrrolidin-1-ylpyridine-2-carboxamide |
| SMILES | N#CN1CCC(CNC(=O)c2cc(N3CCCC3)ccn2)C1 |
| InChI | InChI=1S/C16H21N5O/c17-12-20-8-4-13(11-20)10-19-16(22)15-9-14(3-5-18-15)21-6-1-2-7-21/h3,5,9,13H,1-2,4,6-8,10-11H2,(H,19,22) |
| InChIKey | IHMFMCZUAYSYLG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|