C16H15N7O — CID 139469230
1-(3-cyanophenyl)-N-[(1-cyanopyrrolidin-3-yl)methyl]-1,2,4-triazole-3-carboxamide (PubChem CID 139469230) has the molecular formula C16H15N7O and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-N-[(1-cyanopyrrolidin-3-yl)methyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(3-cyanophenyl)-N-[(1-cyanopyrrolidin-3-yl)methyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 139469230 |
| Molecular Formula | C16H15N7O |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-(3-cyanophenyl)-N-[(1-cyanopyrrolidin-3-yl)methyl]-1,2,4-triazole-3-carboxamide |
| SMILES | N#Cc1cccc(-n2cnc(C(=O)NCC3CCN(C#N)C3)n2)c1 |
| InChI | InChI=1S/C16H15N7O/c17-7-12-2-1-3-14(6-12)23-11-20-15(21-23)16(24)19-8-13-4-5-22(9-13)10-18/h1-3,6,11,13H,4-5,8-9H2,(H,19,24) |
| InChIKey | SBEALMGULHSFTL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|