About 7-methoxyquinoline-3-carboxylate;triethylazanium
7-methoxyquinoline-3-carboxylate;triethylazanium (PubChem CID 129247666) has the molecular formula C17H24N2O3
and a molecular weight of 304.39 g/mol. Its IUPAC name is 7-methoxyquinoline-3-carboxylate;triethylazanium.
Molecular Properties
| Compound Name | 7-methoxyquinoline-3-carboxylate;triethylazanium |
| PubChem CID | 129247666 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 7-methoxyquinoline-3-carboxylate;triethylazanium |
| SMILES | CC[NH+](CC)CC.COc1ccc2cc(C(=O)[O-])cnc2c1 |
| InChI | InChI=1S/C11H9NO3.C6H15N/c1-15-9-3-2-7-4-8(11(13)14)6-12-10(7)5-9;1-4-7(5-2)6-3/h2-6H,1H3,(H,13,14);4-6H2,1-3H3 |
| InChIKey | UQPGFZOORKZTRC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methoxyquinoline-3-carboxylate;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxyquinoline-3-carboxylate;triethylazanium?
The IUPAC name of 7-methoxyquinoline-3-carboxylate;triethylazanium (CID 129247666) is 7-methoxyquinoline-3-carboxylate;triethylazanium.
What is the SMILES notation for 7-methoxyquinoline-3-carboxylate;triethylazanium?
The canonical SMILES for 7-methoxyquinoline-3-carboxylate;triethylazanium is CC[NH+](CC)CC.COc1ccc2cc(C(=O)[O-])cnc2c1.
What is the InChIKey of 7-methoxyquinoline-3-carboxylate;triethylazanium?
The InChIKey is UQPGFZOORKZTRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3.C6H15N/c1-15-9-3-2-7-4-8(11(13)14)6-12-10(7)5-9;1-4-7(5-2)6-3/h2-6H,1H3,(H,13,14);4-6H2,1-3H3.
What are the key properties of 7-methoxyquinoline-3-carboxylate;triethylazanium?
7-methoxyquinoline-3-carboxylate;triethylazanium has a molecular weight of 304.39 g/mol, XLogP of 0.54, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxyquinoline-3-carboxylate;triethylazanium is sourced from PubChem (CID 129247666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).