About ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate
ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate (PubChem CID 158875379) has the molecular formula C24H22N2O6
and a molecular weight of 434.45 g/mol. Its IUPAC name is ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate |
| PubChem CID | 158875379 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(OC)ccc2c1.COC(=O)c1cnc2cc(O)ccc2c1 |
| InChI | InChI=1S/C13H13NO3.C11H9NO3/c1-3-17-13(15)10-6-9-4-5-11(16-2)7-12(9)14-8-10;1-15-11(14)8-4-7-2-3-9(13)5-10(7)12-6-8/h4-8H,3H2,1-2H3;2-6,13H,1H3 |
| InChIKey | JCJDEBZQRVUYHN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate?
The IUPAC name of ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate (CID 158875379) is ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate.
What is the SMILES notation for ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate?
The canonical SMILES for ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate is CCOC(=O)c1cnc2cc(OC)ccc2c1.COC(=O)c1cnc2cc(O)ccc2c1.
What is the InChIKey of ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate?
The InChIKey is JCJDEBZQRVUYHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3.C11H9NO3/c1-3-17-13(15)10-6-9-4-5-11(16-2)7-12(9)14-8-10;1-15-11(14)8-4-7-2-3-9(13)5-10(7)12-6-8/h4-8H,3H2,1-2H3;2-6,13H,1H3.
What are the key properties of ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate?
ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate has a molecular weight of 434.45 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-methoxyquinoline-3-carboxylate;methyl 7-hydroxyquinoline-3-carboxylate is sourced from PubChem (CID 158875379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).