C15H14BrFN4O — CID 129248131
5-amino-3-(4-bromo-2-fluorophenyl)-1-(oxan-3-yl)pyrazole-4-carbonitrile (PubChem CID 129248131) has the molecular formula C15H14BrFN4O and a molecular weight of 365.21 g/mol. Its IUPAC name is 5-amino-3-(4-bromo-2-fluorophenyl)-1-(oxan-3-yl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(4-bromo-2-fluorophenyl)-1-(oxan-3-yl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 129248131 |
| Molecular Formula | C15H14BrFN4O |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 5-amino-3-(4-bromo-2-fluorophenyl)-1-(oxan-3-yl)pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Br)cc2F)nn(C2CCCOC2)c1N |
| InChI | InChI=1S/C15H14BrFN4O/c16-9-3-4-11(13(17)6-9)14-12(7-18)15(19)21(20-14)10-2-1-5-22-8-10/h3-4,6,10H,1-2,5,8,19H2 |
| InChIKey | XDJLILOAOJFEBT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |