About fluoro indole-1-carboxylate
fluoro indole-1-carboxylate (PubChem CID 129249849) has the molecular formula C9H6FNO2
and a molecular weight of 179.15 g/mol. Its IUPAC name is fluoro indole-1-carboxylate.
Molecular Properties
| Compound Name | fluoro indole-1-carboxylate |
| PubChem CID | 129249849 |
| Molecular Formula | C9H6FNO2 |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | fluoro indole-1-carboxylate |
| SMILES | O=C(OF)n1ccc2ccccc21 |
| InChI | InChI=1S/C9H6FNO2/c10-13-9(12)11-6-5-7-3-1-2-4-8(7)11/h1-6H |
| InChIKey | YFVZZCCZTZBONL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze fluoro indole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro indole-1-carboxylate?
The IUPAC name of fluoro indole-1-carboxylate (CID 129249849) is fluoro indole-1-carboxylate.
What is the SMILES notation for fluoro indole-1-carboxylate?
The canonical SMILES for fluoro indole-1-carboxylate is O=C(OF)n1ccc2ccccc21.
What is the InChIKey of fluoro indole-1-carboxylate?
The InChIKey is YFVZZCCZTZBONL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNO2/c10-13-9(12)11-6-5-7-3-1-2-4-8(7)11/h1-6H.
What are the key properties of fluoro indole-1-carboxylate?
fluoro indole-1-carboxylate has a molecular weight of 179.15 g/mol, XLogP of 2.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro indole-1-carboxylate is sourced from PubChem (CID 129249849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).