About 1-indol-1-ylethanone;hydrochloride
1-indol-1-ylethanone;hydrochloride (PubChem CID 21333501) has the molecular formula C10H10ClNO
and a molecular weight of 195.65 g/mol. Its IUPAC name is 1-indol-1-ylethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-indol-1-ylethanone;hydrochloride |
| PubChem CID | 21333501 |
| Molecular Formula | C10H10ClNO |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 1-indol-1-ylethanone;hydrochloride |
| SMILES | CC(=O)n1ccc2ccccc21.Cl |
| InChI | InChI=1S/C10H9NO.ClH/c1-8(12)11-7-6-9-4-2-3-5-10(9)11;/h2-7H,1H3;1H |
| InChIKey | GHAKBSKBXJFWQL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-indol-1-ylethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-indol-1-ylethanone;hydrochloride?
The IUPAC name of 1-indol-1-ylethanone;hydrochloride (CID 21333501) is 1-indol-1-ylethanone;hydrochloride.
What is the SMILES notation for 1-indol-1-ylethanone;hydrochloride?
The canonical SMILES for 1-indol-1-ylethanone;hydrochloride is CC(=O)n1ccc2ccccc21.Cl.
What is the InChIKey of 1-indol-1-ylethanone;hydrochloride?
The InChIKey is GHAKBSKBXJFWQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.ClH/c1-8(12)11-7-6-9-4-2-3-5-10(9)11;/h2-7H,1H3;1H.
What are the key properties of 1-indol-1-ylethanone;hydrochloride?
1-indol-1-ylethanone;hydrochloride has a molecular weight of 195.65 g/mol, XLogP of 2.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-indol-1-ylethanone;hydrochloride is sourced from PubChem (CID 21333501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).