C21H17ClFN7O2 — CID 129250002
1-[(4-chloro-1H-indol-2-yl)methyl]-8-[(6-fluoro-3-pyridinyl)amino]-3,7-dimethylpurine-2,6-dione (PubChem CID 129250002) has the molecular formula C21H17ClFN7O2 and a molecular weight of 453.87 g/mol. Its IUPAC name is 1-[(4-chloro-1H-indol-2-yl)methyl]-8-[(6-fluoro-3-pyridinyl)amino]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[(4-chloro-1H-indol-2-yl)methyl]-8-[(6-fluoro-3-pyridinyl)amino]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 129250002 |
| Molecular Formula | C21H17ClFN7O2 |
| Molecular Weight | 453.87 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 1-[(4-chloro-1H-indol-2-yl)methyl]-8-[(6-fluoro-3-pyridinyl)amino]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(Nc2ccc(F)nc2)nc2c1c(=O)n(Cc1cc3c(Cl)cccc3[nH]1)c(=O)n2C |
| InChI | InChI=1S/C21H17ClFN7O2/c1-28-17-18(27-20(28)26-11-6-7-16(23)24-9-11)29(2)21(32)30(19(17)31)10-12-8-13-14(22)4-3-5-15(13)25-12/h3-9,25H,10H2,1-2H3,(H,26,27) |
| InChIKey | OXNQLQLLAYINPX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.87 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|