C21H24ClN9O2 — CID 137365425
8-[[(1R,2S)-2-(aminodiazenyl)cyclopentyl]amino]-1-[(4-chloro-1H-indol-2-yl)methyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 137365425) has the molecular formula C21H24ClN9O2 and a molecular weight of 469.94 g/mol. Its IUPAC name is 8-[[(1R,2S)-2-(aminodiazenyl)cyclopentyl]amino]-1-[(4-chloro-1H-indol-2-yl)methyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-[[(1R,2S)-2-(aminodiazenyl)cyclopentyl]amino]-1-[(4-chloro-1H-indol-2-yl)methyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 137365425 |
| Molecular Formula | C21H24ClN9O2 |
| Molecular Weight | 469.94 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 8-[[(1R,2S)-2-(aminodiazenyl)cyclopentyl]amino]-1-[(4-chloro-1H-indol-2-yl)methyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(N[C@@H]2CCC[C@@H]2/N=N\N)nc2c1c(=O)n(Cc1cc3c(Cl)cccc3[nH]1)c(=O)n2C |
| InChI | InChI=1S/C21H24ClN9O2/c1-29-17-18(26-20(29)25-15-7-4-8-16(15)27-28-23)30(2)21(33)31(19(17)32)10-11-9-12-13(22)5-3-6-14(12)24-11/h3,5-6,9,15-16,24H,4,7-8,10H2,1-2H3,(H2,23,27)(H,25,26)/t15-,16+/m1/s1 |
| InChIKey | HJNVKWUPWFODLC-CVEARBPZSA-N |
| XLogP | 2.28 |
| TPSA | 140.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.94 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|