C22H15F6N3O5S — CID 129251464
1-[5-fluoro-2-methoxy-4-(1,1,3,3,3-pentafluoropropyl)phenyl]-N-(1,2-oxazol-3-yl)-2-oxoquinoline-6-sulfonamide (PubChem CID 129251464) has the molecular formula C22H15F6N3O5S and a molecular weight of 547.43 g/mol. Its IUPAC name is 1-[5-fluoro-2-methoxy-4-(1,1,3,3,3-pentafluoropropyl)phenyl]-N-(1,2-oxazol-3-yl)-2-oxoquinoline-6-sulfonamide.
| Compound Name | 1-[5-fluoro-2-methoxy-4-(1,1,3,3,3-pentafluoropropyl)phenyl]-N-(1,2-oxazol-3-yl)-2-oxoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 129251464 |
| Molecular Formula | C22H15F6N3O5S |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | 1-[5-fluoro-2-methoxy-4-(1,1,3,3,3-pentafluoropropyl)phenyl]-N-(1,2-oxazol-3-yl)-2-oxoquinoline-6-sulfonamide |
| SMILES | COc1cc(C(F)(F)CC(F)(F)F)c(F)cc1-n1c(=O)ccc2cc(S(=O)(=O)Nc3ccon3)ccc21 |
| InChI | InChI=1S/C22H15F6N3O5S/c1-35-18-9-14(21(24,25)11-22(26,27)28)15(23)10-17(18)31-16-4-3-13(8-12(16)2-5-20(31)32)37(33,34)30-19-6-7-36-29-19/h2-10H,11H2,1H3,(H,29,30) |
| InChIKey | BRRICJKOMBRMCM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |