C22H18F6N3O5PS — CID 157198313
1-[5-fluoro-2-methoxy-4-(2,2,3,3,3-pentafluoropropyl)phenyl]-N-(1,2-oxazol-3-yl)-2-oxoquinoline-6-sulfonamide;phosphane (PubChem CID 157198313) has the molecular formula C22H18F6N3O5PS and a molecular weight of 581.43 g/mol. Its IUPAC name is 1-[5-fluoro-2-methoxy-4-(2,2,3,3,3-pentafluoropropyl)phenyl]-N-(1,2-oxazol-3-yl)-2-oxoquinoline-6-sulfonamide;phosphane.
| Compound Name | 1-[5-fluoro-2-methoxy-4-(2,2,3,3,3-pentafluoropropyl)phenyl]-N-(1,2-oxazol-3-yl)-2-oxoquinoline-6-sulfonamide;phosphane |
|---|---|
| PubChem CID | 157198313 |
| Molecular Formula | C22H18F6N3O5PS |
| Molecular Weight | 581.43 g/mol |
| Exact Mass | 581.06 |
| IUPAC Name | 1-[5-fluoro-2-methoxy-4-(2,2,3,3,3-pentafluoropropyl)phenyl]-N-(1,2-oxazol-3-yl)-2-oxoquinoline-6-sulfonamide;phosphane |
| SMILES | COc1cc(CC(F)(F)C(F)(F)F)c(F)cc1-n1c(=O)ccc2cc(S(=O)(=O)Nc3ccon3)ccc21.P |
| InChI | InChI=1S/C22H15F6N3O5S.H3P/c1-35-18-9-13(11-21(24,25)22(26,27)28)15(23)10-17(18)31-16-4-3-14(8-12(16)2-5-20(31)32)37(33,34)30-19-6-7-36-29-19;/h2-10H,11H2,1H3,(H,29,30);1H3 |
| InChIKey | AQMSQERSWQCLJZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|