C24H22F4N4O4S — CID 145336968
1-[5-fluoro-2-methoxy-4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-6-[hydroxy-(1,2-oxazol-3-ylamino)amino]sulfanylquinolin-2-one (PubChem CID 145336968) has the molecular formula C24H22F4N4O4S and a molecular weight of 538.52 g/mol. Its IUPAC name is 1-[5-fluoro-2-methoxy-4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-6-[hydroxy-(1,2-oxazol-3-ylamino)amino]sulfanylquinolin-2-one.
| Compound Name | 1-[5-fluoro-2-methoxy-4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-6-[hydroxy-(1,2-oxazol-3-ylamino)amino]sulfanylquinolin-2-one |
|---|---|
| PubChem CID | 145336968 |
| Molecular Formula | C24H22F4N4O4S |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 1-[5-fluoro-2-methoxy-4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-6-[hydroxy-(1,2-oxazol-3-ylamino)amino]sulfanylquinolin-2-one |
| SMILES | COc1cc(CC(C)(C)C(F)(F)F)c(F)cc1-n1c(=O)ccc2cc(SN(O)Nc3ccon3)ccc21 |
| InChI | InChI=1S/C24H22F4N4O4S/c1-23(2,24(26,27)28)13-15-11-20(35-3)19(12-17(15)25)31-18-6-5-16(10-14(18)4-7-22(31)33)37-32(34)29-21-8-9-36-30-21/h4-12,34H,13H2,1-3H3,(H,29,30) |
| InChIKey | DBZCTHSOTPCYOP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|