C26H18F3N3O3S — CID 144759127
1-[2-methoxy-4-[3-(trifluoromethyl)phenyl]phenyl]-6-(1,2-oxazol-3-ylamino)sulfanylquinolin-2-one (PubChem CID 144759127) has the molecular formula C26H18F3N3O3S and a molecular weight of 509.51 g/mol. Its IUPAC name is 1-[2-methoxy-4-[3-(trifluoromethyl)phenyl]phenyl]-6-(1,2-oxazol-3-ylamino)sulfanylquinolin-2-one.
| Compound Name | 1-[2-methoxy-4-[3-(trifluoromethyl)phenyl]phenyl]-6-(1,2-oxazol-3-ylamino)sulfanylquinolin-2-one |
|---|---|
| PubChem CID | 144759127 |
| Molecular Formula | C26H18F3N3O3S |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 1-[2-methoxy-4-[3-(trifluoromethyl)phenyl]phenyl]-6-(1,2-oxazol-3-ylamino)sulfanylquinolin-2-one |
| SMILES | COc1cc(-c2cccc(C(F)(F)F)c2)ccc1-n1c(=O)ccc2cc(SNc3ccon3)ccc21 |
| InChI | InChI=1S/C26H18F3N3O3S/c1-34-23-15-17(16-3-2-4-19(13-16)26(27,28)29)5-8-22(23)32-21-9-7-20(14-18(21)6-10-25(32)33)36-31-24-11-12-35-30-24/h2-15H,1H3,(H,30,31) |
| InChIKey | UNMQZZFRBQVXPJ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|