C25H24F4N4O5S — CID 139531048
(4aS,8aS)-1-[5-fluoro-2-methoxy-4-[3-(trifluoromethyl)phenyl]phenyl]-N-(1,2-oxazol-3-yl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-sulfonamide (PubChem CID 139531048) has the molecular formula C25H24F4N4O5S and a molecular weight of 568.55 g/mol. Its IUPAC name is (4aS,8aS)-1-[5-fluoro-2-methoxy-4-[3-(trifluoromethyl)phenyl]phenyl]-N-(1,2-oxazol-3-yl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-sulfonamide.
| Compound Name | (4aS,8aS)-1-[5-fluoro-2-methoxy-4-[3-(trifluoromethyl)phenyl]phenyl]-N-(1,2-oxazol-3-yl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-sulfonamide |
|---|---|
| PubChem CID | 139531048 |
| Molecular Formula | C25H24F4N4O5S |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | (4aS,8aS)-1-[5-fluoro-2-methoxy-4-[3-(trifluoromethyl)phenyl]phenyl]-N-(1,2-oxazol-3-yl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-sulfonamide |
| SMILES | COc1cc(-c2cccc(C(F)(F)F)c2)c(F)cc1N1C(=O)CC[C@H]2CN(S(=O)(=O)Nc3ccon3)CC[C@@H]21 |
| InChI | InChI=1S/C25H24F4N4O5S/c1-37-22-12-18(15-3-2-4-17(11-15)25(27,28)29)19(26)13-21(22)33-20-7-9-32(14-16(20)5-6-24(33)34)39(35,36)31-23-8-10-38-30-23/h2-4,8,10-13,16,20H,5-7,9,14H2,1H3,(H,30,31)/t16-,20-/m0/s1 |
| InChIKey | HITXLUTUQDNCFV-JXFKEZNVSA-N |
| XLogP | 4.68 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |