C24H22F4N4O6S — CID 139530995
(4aS,8aS)-1-[5-fluoro-2-methoxy-4-[3-(trifluoromethyl)phenyl]phenyl]-N-(1,2-oxazol-3-yl)-2-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-d][1,3]oxazine-6-sulfonamide (PubChem CID 139530995) has the molecular formula C24H22F4N4O6S and a molecular weight of 570.52 g/mol. Its IUPAC name is (4aS,8aS)-1-[5-fluoro-2-methoxy-4-[3-(trifluoromethyl)phenyl]phenyl]-N-(1,2-oxazol-3-yl)-2-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-d][1,3]oxazine-6-sulfonamide.
| Compound Name | (4aS,8aS)-1-[5-fluoro-2-methoxy-4-[3-(trifluoromethyl)phenyl]phenyl]-N-(1,2-oxazol-3-yl)-2-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-d][1,3]oxazine-6-sulfonamide |
|---|---|
| PubChem CID | 139530995 |
| Molecular Formula | C24H22F4N4O6S |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | (4aS,8aS)-1-[5-fluoro-2-methoxy-4-[3-(trifluoromethyl)phenyl]phenyl]-N-(1,2-oxazol-3-yl)-2-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-d][1,3]oxazine-6-sulfonamide |
| SMILES | COc1cc(-c2cccc(C(F)(F)F)c2)c(F)cc1N1C(=O)OC[C@H]2CN(S(=O)(=O)Nc3ccon3)CC[C@@H]21 |
| InChI | InChI=1S/C24H22F4N4O6S/c1-36-21-10-17(14-3-2-4-16(9-14)24(26,27)28)18(25)11-20(21)32-19-5-7-31(12-15(19)13-37-23(32)33)39(34,35)30-22-6-8-38-29-22/h2-4,6,8-11,15,19H,5,7,12-13H2,1H3,(H,29,30)/t15-,19+/m1/s1 |
| InChIKey | FICCRPXKPQBWLY-BEFAXECRSA-N |
| XLogP | 4.51 |
| TPSA | 114.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |