C24H22F5N5O5S — CID 139554398
(8aS)-1-[5-fluoro-4-[2-fluoro-5-(trifluoromethyl)phenyl]-2-methoxyphenyl]-6-[hydroxy-(1,2-oxazol-3-ylamino)sulfanylamino]-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one (PubChem CID 139554398) has the molecular formula C24H22F5N5O5S and a molecular weight of 587.53 g/mol. Its IUPAC name is (8aS)-1-[5-fluoro-4-[2-fluoro-5-(trifluoromethyl)phenyl]-2-methoxyphenyl]-6-[hydroxy-(1,2-oxazol-3-ylamino)sulfanylamino]-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one.
| Compound Name | (8aS)-1-[5-fluoro-4-[2-fluoro-5-(trifluoromethyl)phenyl]-2-methoxyphenyl]-6-[hydroxy-(1,2-oxazol-3-ylamino)sulfanylamino]-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 139554398 |
| Molecular Formula | C24H22F5N5O5S |
| Molecular Weight | 587.53 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | (8aS)-1-[5-fluoro-4-[2-fluoro-5-(trifluoromethyl)phenyl]-2-methoxyphenyl]-6-[hydroxy-(1,2-oxazol-3-ylamino)sulfanylamino]-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one |
| SMILES | COc1cc(-c2cc(C(F)(F)F)ccc2F)c(F)cc1N1C(=O)COC2CN(N(O)SNc3ccon3)CC[C@@H]21 |
| InChI | InChI=1S/C24H22F5N5O5S/c1-37-20-9-15(14-8-13(24(27,28)29)2-3-16(14)25)17(26)10-19(20)33-18-4-6-32(11-21(18)38-12-23(33)35)34(36)40-31-22-5-7-39-30-22/h2-3,5,7-10,18,21,36H,4,6,11-12H2,1H3,(H,30,31)/t18-,21?/m0/s1 |
| InChIKey | HQGGNCHSGYBBTK-YMXDCFFPSA-N |
| XLogP | 4.73 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|