C24H24F3N5O5S — CID 139554405
1-[4-[3-(difluoromethyl)phenyl]-5-fluoro-2-methoxyphenyl]-6-[hydroxy-(1,2-oxazol-3-ylamino)sulfanylamino]-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one (PubChem CID 139554405) has the molecular formula C24H24F3N5O5S and a molecular weight of 551.55 g/mol. Its IUPAC name is 1-[4-[3-(difluoromethyl)phenyl]-5-fluoro-2-methoxyphenyl]-6-[hydroxy-(1,2-oxazol-3-ylamino)sulfanylamino]-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one.
| Compound Name | 1-[4-[3-(difluoromethyl)phenyl]-5-fluoro-2-methoxyphenyl]-6-[hydroxy-(1,2-oxazol-3-ylamino)sulfanylamino]-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 139554405 |
| Molecular Formula | C24H24F3N5O5S |
| Molecular Weight | 551.55 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 1-[4-[3-(difluoromethyl)phenyl]-5-fluoro-2-methoxyphenyl]-6-[hydroxy-(1,2-oxazol-3-ylamino)sulfanylamino]-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one |
| SMILES | COc1cc(-c2cccc(C(F)F)c2)c(F)cc1N1C(=O)COC2CN(N(O)SNc3ccon3)CCC21 |
| InChI | InChI=1S/C24H24F3N5O5S/c1-35-20-10-16(14-3-2-4-15(9-14)24(26)27)17(25)11-19(20)31-18-5-7-30(12-21(18)36-13-23(31)33)32(34)38-29-22-6-8-37-28-22/h2-4,6,8-11,18,21,24,34H,5,7,12-13H2,1H3,(H,28,29) |
| InChIKey | LUWYMYMYBXBMMT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|