C24H23F2N3O6S — CID 158487284
(4aS,8aS)-1-[5-fluoro-4-(3-fluorophenyl)-2-methoxyphenyl]-6-(1,2-oxazol-3-ylmethylsulfonyl)-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one (PubChem CID 158487284) has the molecular formula C24H23F2N3O6S and a molecular weight of 519.53 g/mol. Its IUPAC name is (4aS,8aS)-1-[5-fluoro-4-(3-fluorophenyl)-2-methoxyphenyl]-6-(1,2-oxazol-3-ylmethylsulfonyl)-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one.
| Compound Name | (4aS,8aS)-1-[5-fluoro-4-(3-fluorophenyl)-2-methoxyphenyl]-6-(1,2-oxazol-3-ylmethylsulfonyl)-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 158487284 |
| Molecular Formula | C24H23F2N3O6S |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | (4aS,8aS)-1-[5-fluoro-4-(3-fluorophenyl)-2-methoxyphenyl]-6-(1,2-oxazol-3-ylmethylsulfonyl)-5,7,8,8a-tetrahydro-4aH-pyrido[3,4-b][1,4]oxazin-2-one |
| SMILES | COc1cc(-c2cccc(F)c2)c(F)cc1N1C(=O)CO[C@H]2CN(S(=O)(=O)Cc3ccon3)CC[C@@H]21 |
| InChI | InChI=1S/C24H23F2N3O6S/c1-33-22-10-18(15-3-2-4-16(25)9-15)19(26)11-21(22)29-20-5-7-28(12-23(20)34-13-24(29)30)36(31,32)14-17-6-8-35-27-17/h2-4,6,8-11,20,23H,5,7,12-14H2,1H3/t20-,23-/m0/s1 |
| InChIKey | VRVYDXZYQNHAHF-REWPJTCUSA-N |
| XLogP | 2.96 |
| TPSA | 102.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |