C24H17FN4O3S — CID 144759118
1-[5-(6-fluoro-3-pyridinyl)-2-methoxyphenyl]-6-(1,2-oxazol-3-ylamino)sulfanylquinolin-2-one (PubChem CID 144759118) has the molecular formula C24H17FN4O3S and a molecular weight of 460.49 g/mol. Its IUPAC name is 1-[5-(6-fluoro-3-pyridinyl)-2-methoxyphenyl]-6-(1,2-oxazol-3-ylamino)sulfanylquinolin-2-one.
| Compound Name | 1-[5-(6-fluoro-3-pyridinyl)-2-methoxyphenyl]-6-(1,2-oxazol-3-ylamino)sulfanylquinolin-2-one |
|---|---|
| PubChem CID | 144759118 |
| Molecular Formula | C24H17FN4O3S |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-[5-(6-fluoro-3-pyridinyl)-2-methoxyphenyl]-6-(1,2-oxazol-3-ylamino)sulfanylquinolin-2-one |
| SMILES | COc1ccc(-c2ccc(F)nc2)cc1-n1c(=O)ccc2cc(SNc3ccon3)ccc21 |
| InChI | InChI=1S/C24H17FN4O3S/c1-31-21-7-2-15(17-3-8-22(25)26-14-17)13-20(21)29-19-6-5-18(12-16(19)4-9-24(29)30)33-28-23-10-11-32-27-23/h2-14H,1H3,(H,27,28) |
| InChIKey | KOYPMLGGMDYHBS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|