C22H14ClF2NO2S — CID 144758982
[1-[5-fluoro-4-(3-fluorophenyl)-2-methoxyphenyl]-2-oxoquinolin-6-yl] thiohypochlorite (PubChem CID 144758982) has the molecular formula C22H14ClF2NO2S and a molecular weight of 429.88 g/mol. Its IUPAC name is [1-[5-fluoro-4-(3-fluorophenyl)-2-methoxyphenyl]-2-oxoquinolin-6-yl] thiohypochlorite.
| Compound Name | [1-[5-fluoro-4-(3-fluorophenyl)-2-methoxyphenyl]-2-oxoquinolin-6-yl] thiohypochlorite |
|---|---|
| PubChem CID | 144758982 |
| Molecular Formula | C22H14ClF2NO2S |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | [1-[5-fluoro-4-(3-fluorophenyl)-2-methoxyphenyl]-2-oxoquinolin-6-yl] thiohypochlorite |
| SMILES | COc1cc(-c2cccc(F)c2)c(F)cc1-n1c(=O)ccc2cc(SCl)ccc21 |
| InChI | InChI=1S/C22H14ClF2NO2S/c1-28-21-11-17(13-3-2-4-15(24)9-13)18(25)12-20(21)26-19-7-6-16(29-23)10-14(19)5-8-22(26)27/h2-12H,1H3 |
| InChIKey | DVILORIWSYIJMP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |